C12H23N3 — CID 155721831
(3Z)-2-N-[2-(dimethylamino)ethyl]-2-N,3-dimethylhexa-1,3,5-triene-2,5-diamine (PubChem CID 155721831) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (3Z)-2-N-[2-(dimethylamino)ethyl]-2-N,3-dimethylhexa-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z)-2-N-[2-(dimethylamino)ethyl]-2-N,3-dimethylhexa-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 155721831 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (3Z)-2-N-[2-(dimethylamino)ethyl]-2-N,3-dimethylhexa-1,3,5-triene-2,5-diamine |
| SMILES | C=C(N)/C=C(/C)C(=C)N(C)CCN(C)C |
| InChI | InChI=1S/C12H23N3/c1-10(9-11(2)13)12(3)15(6)8-7-14(4)5/h9H,2-3,7-8,13H2,1,4-6H3/b10-9- |
| InChIKey | CEOJKVXQZATLBN-KTKRTIGZSA-N |
| XLogP | 1.41 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|