C19H23ClN2 — CID 155722749
4-(4-chlorophenyl)-5-(2,4-dimethylphenyl)-2,3-dihydro-1H-pyrazole;ethane (PubChem CID 155722749) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dimethylphenyl)-2,3-dihydro-1H-pyrazole;ethane.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dimethylphenyl)-2,3-dihydro-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 155722749 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dimethylphenyl)-2,3-dihydro-1H-pyrazole;ethane |
| SMILES | CC.Cc1ccc(C2=C(c3ccc(Cl)cc3)CNN2)c(C)c1 |
| InChI | InChI=1S/C17H17ClN2.C2H6/c1-11-3-8-15(12(2)9-11)17-16(10-19-20-17)13-4-6-14(18)7-5-13;1-2/h3-9,19-20H,10H2,1-2H3;1-2H3 |
| InChIKey | XSWJFGTVNCYZFC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|