C29H27ClN6O3 — CID 155723127
5-[4-amino-7-methyl-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-[(5-chloro-2-pyridinyl)oxy]phenol;2-methylprop-2-enal (PubChem CID 155723127) has the molecular formula C29H27ClN6O3 and a molecular weight of 543.03 g/mol. Its IUPAC name is 5-[4-amino-7-methyl-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-[(5-chloro-2-pyridinyl)oxy]phenol;2-methylprop-2-enal.
| Compound Name | 5-[4-amino-7-methyl-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-[(5-chloro-2-pyridinyl)oxy]phenol;2-methylprop-2-enal |
|---|---|
| PubChem CID | 155723127 |
| Molecular Formula | C29H27ClN6O3 |
| Molecular Weight | 543.03 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 5-[4-amino-7-methyl-6-[4-(methylamino)phenyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-[(5-chloro-2-pyridinyl)oxy]phenol;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CNc1ccc(-c2c(-c3ccc(Oc4ccc(Cl)cn4)c(O)c3)c3c(N)ncnc3n2C)cc1 |
| InChI | InChI=1S/C25H21ClN6O2.C4H6O/c1-28-17-7-3-14(4-8-17)23-21(22-24(27)30-13-31-25(22)32(23)2)15-5-9-19(18(33)11-15)34-20-10-6-16(26)12-29-20;1-4(2)3-5/h3-13,28,33H,1-2H3,(H2,27,30,31);3H,1H2,2H3 |
| InChIKey | CLTOSUCZDVNOKD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.03 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|