C24H25ClN2O4 — CID 155723706
tert-butyl 3-(6-chloro-5-methoxy-10-methyl-9-oxoacridin-3-yl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 155723706) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is tert-butyl 3-(6-chloro-5-methoxy-10-methyl-9-oxoacridin-3-yl)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-(6-chloro-5-methoxy-10-methyl-9-oxoacridin-3-yl)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 155723706 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | tert-butyl 3-(6-chloro-5-methoxy-10-methyl-9-oxoacridin-3-yl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | COc1c(Cl)ccc2c(=O)c3ccc(C4=CCN(C(=O)OC(C)(C)C)C4)cc3n(C)c12 |
| InChI | InChI=1S/C24H25ClN2O4/c1-24(2,3)31-23(29)27-11-10-15(13-27)14-6-7-16-19(12-14)26(4)20-17(21(16)28)8-9-18(25)22(20)30-5/h6-10,12H,11,13H2,1-5H3 |
| InChIKey | XXRTURWKLCYBMF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|