C18H19N3O3 — CID 155723907
2-[9-(dimethylamino)-6-hydroxy-2,8-dimethyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetaldehyde (PubChem CID 155723907) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[9-(dimethylamino)-6-hydroxy-2,8-dimethyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetaldehyde.
| Compound Name | 2-[9-(dimethylamino)-6-hydroxy-2,8-dimethyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetaldehyde |
|---|---|
| PubChem CID | 155723907 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[9-(dimethylamino)-6-hydroxy-2,8-dimethyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetaldehyde |
| SMILES | Cc1ccc2c(=O)c3c(O)cc(C)c(N(C)C)c3n(CC=O)c2n1 |
| InChI | InChI=1S/C18H19N3O3/c1-10-9-13(23)14-16(15(10)20(3)4)21(7-8-22)18-12(17(14)24)6-5-11(2)19-18/h5-6,8-9,23H,7H2,1-4H3 |
| InChIKey | IQSQHKDERGOAGO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|