C17H13ClN2O3S — CID 164840495
2-(2-acetyl-8-chloro-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl)acetaldehyde (PubChem CID 164840495) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is 2-(2-acetyl-8-chloro-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl)acetaldehyde.
| Compound Name | 2-(2-acetyl-8-chloro-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl)acetaldehyde |
|---|---|
| PubChem CID | 164840495 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-(2-acetyl-8-chloro-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl)acetaldehyde |
| SMILES | CSc1c(Cl)ccc2c(=O)c3ccc(C(C)=O)nc3n(CC=O)c12 |
| InChI | InChI=1S/C17H13ClN2O3S/c1-9(22)13-6-4-11-15(23)10-3-5-12(18)16(24-2)14(10)20(7-8-21)17(11)19-13/h3-6,8H,7H2,1-2H3 |
| InChIKey | USHGFGGYRMJAPV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|