C23H26ClN3O3S — CID 167655107
ethyl 2-[8-chloro-2-[(3-methylcyclobutyl)methylamino]-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate (PubChem CID 167655107) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is ethyl 2-[8-chloro-2-[(3-methylcyclobutyl)methylamino]-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate.
| Compound Name | ethyl 2-[8-chloro-2-[(3-methylcyclobutyl)methylamino]-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate |
|---|---|
| PubChem CID | 167655107 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | ethyl 2-[8-chloro-2-[(3-methylcyclobutyl)methylamino]-9-methylsulfanyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate |
| SMILES | CCOC(=O)Cn1c2nc(NCC3CC(C)C3)ccc2c(=O)c2ccc(Cl)c(SC)c21 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-4-30-19(28)12-27-20-15(5-7-17(24)22(20)31-3)21(29)16-6-8-18(26-23(16)27)25-11-14-9-13(2)10-14/h5-8,13-14H,4,9-12H2,1-3H3,(H,25,26) |
| InChIKey | VLCXKJRLYNCELI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|