C20H20ClN3O3 — CID 164840475
ethyl 2-[8-chloro-2-(dimethylamino)-9-ethenyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate (PubChem CID 164840475) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is ethyl 2-[8-chloro-2-(dimethylamino)-9-ethenyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate.
| Compound Name | ethyl 2-[8-chloro-2-(dimethylamino)-9-ethenyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate |
|---|---|
| PubChem CID | 164840475 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | ethyl 2-[8-chloro-2-(dimethylamino)-9-ethenyl-5-oxobenzo[b][1,8]naphthyridin-10-yl]acetate |
| SMILES | C=Cc1c(Cl)ccc2c(=O)c3ccc(N(C)C)nc3n(CC(=O)OCC)c12 |
| InChI | InChI=1S/C20H20ClN3O3/c1-5-12-15(21)9-7-13-18(12)24(11-17(25)27-6-2)20-14(19(13)26)8-10-16(22-20)23(3)4/h5,7-10H,1,6,11H2,2-4H3 |
| InChIKey | LKKNUYABTXEBFD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|