C17H16ClN3NaO3S- — CID 164840534
sodium;8-chloro-2-(dimethylamino)-9-methylsulfanyl-10-(2-oxoethyl)benzo[b][1,8]naphthyridin-5-one;hydroxide (PubChem CID 164840534) has the molecular formula C17H16ClN3NaO3S- and a molecular weight of 400.84 g/mol. Its IUPAC name is sodium;8-chloro-2-(dimethylamino)-9-methylsulfanyl-10-(2-oxoethyl)benzo[b][1,8]naphthyridin-5-one;hydroxide.
| Compound Name | sodium;8-chloro-2-(dimethylamino)-9-methylsulfanyl-10-(2-oxoethyl)benzo[b][1,8]naphthyridin-5-one;hydroxide |
|---|---|
| PubChem CID | 164840534 |
| Molecular Formula | C17H16ClN3NaO3S- |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | sodium;8-chloro-2-(dimethylamino)-9-methylsulfanyl-10-(2-oxoethyl)benzo[b][1,8]naphthyridin-5-one;hydroxide |
| SMILES | CSc1c(Cl)ccc2c(=O)c3ccc(N(C)C)nc3n(C[C-]=O)c12.[Na+].[OH-] |
| InChI | InChI=1S/C17H15ClN3O2S.Na.H2O/c1-20(2)13-7-5-11-15(23)10-4-6-12(18)16(24-3)14(10)21(8-9-22)17(11)19-13;;/h4-7H,8H2,1-3H3;;1H2/q-1;+1;/p-1 |
| InChIKey | VKPOZKBJNATPAU-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 85.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|