C13H23NO2S — CID 155725053
tert-butyl 1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrole-2-carboxylate (PubChem CID 155725053) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is tert-butyl 1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155725053 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | tert-butyl 1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCSCCC2C1 |
| InChI | InChI=1S/C13H23NO2S/c1-13(2,3)16-12(15)14-8-10-4-6-17-7-5-11(10)9-14/h10-11H,4-9H2,1-3H3 |
| InChIKey | FWVZTXCNQHCMCG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |