C20H36O6 — CID 155725463
cis-2-ethylbutyl (1R,2R)-2-[(3R)-3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxybutyl]cyclopropane-1-carboxylate (PubChem CID 155725463) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is cis-2-ethylbutyl (1R,2R)-2-[(3R)-3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxybutyl]cyclopropane-1-carboxylate.
| Compound Name | cis-2-ethylbutyl (1R,2R)-2-[(3R)-3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxybutyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 155725463 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | cis-2-ethylbutyl (1R,2R)-2-[(3R)-3-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxybutyl]cyclopropane-1-carboxylate |
| SMILES | CCC(CC)COC(=O)[C@@H]1C[C@H]1CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O6/c1-5-14(6-2)11-24-19(23)16-9-15(16)8-7-12(3)25-20-18(22)10-17(21)13(4)26-20/h12-18,20-22H,5-11H2,1-4H3/t12-,13+,15-,16-,17-,18-,20-/m1/s1 |
| InChIKey | FJIRNUYFVQGGFV-UPCJGDFVSA-N |
| XLogP | 2.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |