C19H31N — CID 155725625
N-[(1E)-1-(5-tert-butyl-2-methylcyclohexen-1-yl)-3-methylbuta-1,3-dien-2-yl]propan-2-imine (PubChem CID 155725625) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is N-[(1E)-1-(5-tert-butyl-2-methylcyclohexen-1-yl)-3-methylbuta-1,3-dien-2-yl]propan-2-imine.
| Compound Name | N-[(1E)-1-(5-tert-butyl-2-methylcyclohexen-1-yl)-3-methylbuta-1,3-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 155725625 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-[(1E)-1-(5-tert-butyl-2-methylcyclohexen-1-yl)-3-methylbuta-1,3-dien-2-yl]propan-2-imine |
| SMILES | C=C(C)/C(=C\C1=C(C)CCC(C(C)(C)C)C1)N=C(C)C |
| InChI | InChI=1S/C19H31N/c1-13(2)18(20-14(3)4)12-16-11-17(19(6,7)8)10-9-15(16)5/h12,17H,1,9-11H2,2-8H3/b18-12+ |
| InChIKey | CWGUFJOSUPZDJM-LDADJPATSA-N |
| XLogP | 6.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|