C18H23F2N3OS — CID 155725761
N-[3-(2,2-difluoropropylamino)propyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide (PubChem CID 155725761) has the molecular formula C18H23F2N3OS and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[3-(2,2-difluoropropylamino)propyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | N-[3-(2,2-difluoropropylamino)propyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155725761 |
| Molecular Formula | C18H23F2N3OS |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[3-(2,2-difluoropropylamino)propyl]-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide |
| SMILES | CC(F)(F)CNCCCNC(=O)c1cc2cc3c(nc2s1)CCCC3 |
| InChI | InChI=1S/C18H23F2N3OS/c1-18(19,20)11-21-7-4-8-22-16(24)15-10-13-9-12-5-2-3-6-14(12)23-17(13)25-15/h9-10,21H,2-8,11H2,1H3,(H,22,24) |
| InChIKey | TUFQHFZRRRGRDG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|