C13H21NS — CID 155726356
3-ethyl-2H-1,4-thiazine;3-methylhexa-1,5-diene (PubChem CID 155726356) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 3-ethyl-2H-1,4-thiazine;3-methylhexa-1,5-diene.
| Compound Name | 3-ethyl-2H-1,4-thiazine;3-methylhexa-1,5-diene |
|---|---|
| PubChem CID | 155726356 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-ethyl-2H-1,4-thiazine;3-methylhexa-1,5-diene |
| SMILES | C=CCC(C)C=C.CCC1=NC=CSC1 |
| InChI | InChI=1S/C7H12.C6H9NS/c1-4-6-7(3)5-2;1-2-6-5-8-4-3-7-6/h4-5,7H,1-2,6H2,3H3;3-4H,2,5H2,1H3 |
| InChIKey | YZZZFLPUDGRWTJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|