About 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine
2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine (PubChem CID 156706295) has the molecular formula C12H21NS2
and a molecular weight of 243.44 g/mol. Its IUPAC name is 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine |
| PubChem CID | 156706295 |
| Molecular Formula | C12H21NS2 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine |
| SMILES | CC(C)SCCSCCC1=NC=CCC1 |
| InChI | InChI=1S/C12H21NS2/c1-11(2)15-10-9-14-8-6-12-5-3-4-7-13-12/h4,7,11H,3,5-6,8-10H2,1-2H3 |
| InChIKey | FPZNHLVODKAESQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine?
The IUPAC name of 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine (CID 156706295) is 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine.
What is the SMILES notation for 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine?
The canonical SMILES for 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine is CC(C)SCCSCCC1=NC=CCC1.
What is the InChIKey of 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine?
The InChIKey is FPZNHLVODKAESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NS2/c1-11(2)15-10-9-14-8-6-12-5-3-4-7-13-12/h4,7,11H,3,5-6,8-10H2,1-2H3.
What are the key properties of 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine?
2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine has a molecular weight of 243.44 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-propan-2-ylsulfanylethylsulfanyl)ethyl]-3,4-dihydropyridine is sourced from PubChem (CID 156706295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).