C22H33N3O7 — CID 155727957
ditert-butyl (6R)-3-(3-ethoxy-3-oxopropanoyl)-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate (PubChem CID 155727957) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is ditert-butyl (6R)-3-(3-ethoxy-3-oxopropanoyl)-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate.
| Compound Name | ditert-butyl (6R)-3-(3-ethoxy-3-oxopropanoyl)-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 155727957 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | ditert-butyl (6R)-3-(3-ethoxy-3-oxopropanoyl)-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate |
| SMILES | CCOC(=O)CC(=O)c1nn(C(=O)OC(C)(C)C)c2c1CN(C(=O)OC(C)(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C22H33N3O7/c1-9-30-17(27)11-16(26)18-14-12-24(19(28)31-21(3,4)5)13(2)10-15(14)25(23-18)20(29)32-22(6,7)8/h13H,9-12H2,1-8H3/t13-/m1/s1 |
| InChIKey | NLDUVIPOEMHOKS-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 117.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|