C42H57N3O8Si — CID 155727966
ditert-butyl (6R)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethoxycarbonylpent-4-enoyl]-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate (PubChem CID 155727966) has the molecular formula C42H57N3O8Si and a molecular weight of 760.02 g/mol. Its IUPAC name is ditert-butyl (6R)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethoxycarbonylpent-4-enoyl]-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate.
| Compound Name | ditert-butyl (6R)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethoxycarbonylpent-4-enoyl]-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 155727966 |
| Molecular Formula | C42H57N3O8Si |
| Molecular Weight | 760.02 g/mol |
| Exact Mass | 759.39 |
| IUPAC Name | ditert-butyl (6R)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethoxycarbonylpent-4-enoyl]-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-1,5-dicarboxylate |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(C(=O)OCC)C(=O)c1nn(C(=O)OC(C)(C)C)c2c1CN(C(=O)OC(C)(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C42H57N3O8Si/c1-13-50-37(47)32(24-28(2)27-51-54(42(10,11)12,30-20-16-14-17-21-30)31-22-18-15-19-23-31)36(46)35-33-26-44(38(48)52-40(4,5)6)29(3)25-34(33)45(43-35)39(49)53-41(7,8)9/h14-23,29,32H,2,13,24-27H2,1,3-12H3/t29-,32?/m1/s1 |
| InChIKey | XILYTPYOASQFAH-UYEDPJPISA-N |
| XLogP | 7.23 |
| TPSA | 126.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.02 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|