C20H26BNO4 — CID 155729108
3-methoxy-1-methyl-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]pyrrolidin-2-one (PubChem CID 155729108) has the molecular formula C20H26BNO4 and a molecular weight of 355.24 g/mol. Its IUPAC name is 3-methoxy-1-methyl-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]pyrrolidin-2-one.
| Compound Name | 3-methoxy-1-methyl-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155729108 |
| Molecular Formula | C20H26BNO4 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-methoxy-1-methyl-3-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]pyrrolidin-2-one |
| SMILES | COC1(C#Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2)CCN(C)C1=O |
| InChI | InChI=1S/C20H26BNO4/c1-18(2)19(3,4)26-21(25-18)16-9-7-8-15(14-16)10-11-20(24-6)12-13-22(5)17(20)23/h7-9,14H,12-13H2,1-6H3 |
| InChIKey | OTDCIKPNQIHCON-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|