About N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane
N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane (PubChem CID 155730393) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane.
Molecular Properties
| Compound Name | N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane |
| PubChem CID | 155730393 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane |
| SMILES | CC.CC(=O)NC(CC#N)C(F)(F)F |
| InChI | InChI=1S/C6H7F3N2O.C2H6/c1-4(12)11-5(2-3-10)6(7,8)9;1-2/h5H,2H2,1H3,(H,11,12);1-2H3 |
| InChIKey | HWMAPHMIEWTALI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane?
The IUPAC name of N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane (CID 155730393) is N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane.
What is the SMILES notation for N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane?
The canonical SMILES for N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane is CC.CC(=O)NC(CC#N)C(F)(F)F.
What is the InChIKey of N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane?
The InChIKey is HWMAPHMIEWTALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N2O.C2H6/c1-4(12)11-5(2-3-10)6(7,8)9;1-2/h5H,2H2,1H3,(H,11,12);1-2H3.
What are the key properties of N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane?
N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane has a molecular weight of 210.20 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-1,1,1-trifluoropropan-2-yl)acetamide;ethane is sourced from PubChem (CID 155730393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).