C9H17N2O5S+ — CID 155731194
[(5R)-7-oxo-2-propan-2-yl-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 155731194) has the molecular formula C9H17N2O5S+ and a molecular weight of 265.31 g/mol. Its IUPAC name is [(5R)-7-oxo-2-propan-2-yl-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(5R)-7-oxo-2-propan-2-yl-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 155731194 |
| Molecular Formula | C9H17N2O5S+ |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [(5R)-7-oxo-2-propan-2-yl-6-aza-1-azoniabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(C)C1CC[C@@H]2C[NH+]1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-6(2)8-4-3-7-5-10(8)9(12)11(7)16-17(13,14)15/h6-8H,3-5H2,1-2H3,(H,13,14,15)/p+1/t7-,8?/m1/s1 |
| InChIKey | GERRQJGYVFYLDF-GVHYBUMESA-O |
| XLogP | -0.77 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|