C22H27N3O3 — CID 155731957
tert-butyl 4-amino-5-[C-formyl-N-(4-phenylbut-3-ynyl)carbonimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 155731957) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl 4-amino-5-[C-formyl-N-(4-phenylbut-3-ynyl)carbonimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-5-[C-formyl-N-(4-phenylbut-3-ynyl)carbonimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 155731957 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl 4-amino-5-[C-formyl-N-(4-phenylbut-3-ynyl)carbonimidoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)=C(/C(C=O)=N/CCC#Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(2,3)28-21(27)25-14-12-19(23)18(15-25)20(16-26)24-13-8-7-11-17-9-5-4-6-10-17/h4-6,9-10,16H,8,12-15,23H2,1-3H3/b24-20+ |
| InChIKey | FWTQXZNPYMCUDK-HIXSDJFHSA-N |
| XLogP | 2.92 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|