C20H33N3O3 — CID 155732004
tert-butyl 2-hex-4-ynyl-3-(hydroxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate;ethane (PubChem CID 155732004) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl 2-hex-4-ynyl-3-(hydroxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate;ethane.
| Compound Name | tert-butyl 2-hex-4-ynyl-3-(hydroxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate;ethane |
|---|---|
| PubChem CID | 155732004 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | tert-butyl 2-hex-4-ynyl-3-(hydroxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate;ethane |
| SMILES | CC.CC#CCCCn1nc2c(c1CO)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H27N3O3.C2H6/c1-5-6-7-8-10-21-16(13-22)14-12-20(11-9-15(14)19-21)17(23)24-18(2,3)4;1-2/h22H,7-13H2,1-4H3;1-2H3 |
| InChIKey | JVUTXAVEGHDFQJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|