C19H27N3O3 — CID 164834320
tert-butyl (6R)-3-formyl-2-hex-4-ynyl-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 164834320) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl (6R)-3-formyl-2-hex-4-ynyl-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (6R)-3-formyl-2-hex-4-ynyl-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 164834320 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl (6R)-3-formyl-2-hex-4-ynyl-6-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CC#CCCCn1nc2c(c1C=O)CN(C(=O)OC(C)(C)C)[C@H](C)C2 |
| InChI | InChI=1S/C19H27N3O3/c1-6-7-8-9-10-22-17(13-23)15-12-21(14(2)11-16(15)20-22)18(24)25-19(3,4)5/h13-14H,8-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | ZISNFBAVGNJJQT-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|