C20H31N5O5 — CID 155728016
tert-butyl 11-[methoxy(methyl)carbamoyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 155728016) has the molecular formula C20H31N5O5 and a molecular weight of 421.50 g/mol. Its IUPAC name is tert-butyl 11-[methoxy(methyl)carbamoyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl 11-[methoxy(methyl)carbamoyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 155728016 |
| Molecular Formula | C20H31N5O5 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | tert-butyl 11-[methoxy(methyl)carbamoyl]-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | CON(C)C(=O)C1CN(C)C(=O)c2c3c(nn2C1)CC(C)N(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C20H31N5O5/c1-12-8-15-14(11-24(12)19(28)30-20(2,3)4)16-18(27)22(5)9-13(10-25(16)21-15)17(26)23(6)29-7/h12-13H,8-11H2,1-7H3 |
| InChIKey | MKCBCHLGFMTCNM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|