C26H30N6O6 — CID 167152103
5-O-benzyl 4-O-tert-butyl 13-methyl-11-(1,2,4-oxadiazol-5-yl)-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,5-dicarboxylate (PubChem CID 167152103) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is 5-O-benzyl 4-O-tert-butyl 13-methyl-11-(1,2,4-oxadiazol-5-yl)-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,5-dicarboxylate.
| Compound Name | 5-O-benzyl 4-O-tert-butyl 13-methyl-11-(1,2,4-oxadiazol-5-yl)-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 167152103 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 5-O-benzyl 4-O-tert-butyl 13-methyl-11-(1,2,4-oxadiazol-5-yl)-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,5-dicarboxylate |
| SMILES | CN1CC(c2ncno2)Cn2nc3c(c2C1=O)CN(C(=O)OC(C)(C)C)C(C(=O)OCc1ccccc1)C3 |
| InChI | InChI=1S/C26H30N6O6/c1-26(2,3)37-25(35)31-13-18-19(10-20(31)24(34)36-14-16-8-6-5-7-9-16)29-32-12-17(22-27-15-28-38-22)11-30(4)23(33)21(18)32/h5-9,15,17,20H,10-14H2,1-4H3 |
| InChIKey | ZXVWBEDWVLLSEI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |