C16H18ClN5 — CID 155735047
4-chloro-1-N-(1-cyclopropylpyrazol-4-yl)-6-methanimidoyl-3-N-prop-2-enylbenzene-1,3-diamine (PubChem CID 155735047) has the molecular formula C16H18ClN5 and a molecular weight of 315.81 g/mol. Its IUPAC name is 4-chloro-1-N-(1-cyclopropylpyrazol-4-yl)-6-methanimidoyl-3-N-prop-2-enylbenzene-1,3-diamine.
| Compound Name | 4-chloro-1-N-(1-cyclopropylpyrazol-4-yl)-6-methanimidoyl-3-N-prop-2-enylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 155735047 |
| Molecular Formula | C16H18ClN5 |
| Molecular Weight | 315.81 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-chloro-1-N-(1-cyclopropylpyrazol-4-yl)-6-methanimidoyl-3-N-prop-2-enylbenzene-1,3-diamine |
| SMILES | [H]/N=C/c1cc(Cl)c(NCC=C)cc1Nc1cnn(C2CC2)c1 |
| InChI | InChI=1S/C16H18ClN5/c1-2-5-19-16-7-15(11(8-18)6-14(16)17)21-12-9-20-22(10-12)13-3-4-13/h2,6-10,13,18-19,21H,1,3-5H2/b18-8+ |
| InChIKey | OOTJUBWPMFXTTE-QGMBQPNBSA-N |
| XLogP | 4.21 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|