C11H10N4O — CID 155737396
N-[(5-cyano-1H-pyrrolo[3,2-b]pyridin-2-yl)methyl]-N-methylformamide (PubChem CID 155737396) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is N-[(5-cyano-1H-pyrrolo[3,2-b]pyridin-2-yl)methyl]-N-methylformamide.
| Compound Name | N-[(5-cyano-1H-pyrrolo[3,2-b]pyridin-2-yl)methyl]-N-methylformamide |
|---|---|
| PubChem CID | 155737396 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(5-cyano-1H-pyrrolo[3,2-b]pyridin-2-yl)methyl]-N-methylformamide |
| SMILES | CN(C=O)Cc1cc2nc(C#N)ccc2[nH]1 |
| InChI | InChI=1S/C11H10N4O/c1-15(7-16)6-9-4-11-10(14-9)3-2-8(5-12)13-11/h2-4,7,14H,6H2,1H3 |
| InChIKey | WANHIWJNNNSZHE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|