C10H19N3 — CID 155737997
(1E,3Z)-1-(3-methylpiperidin-1-yl)buta-1,3-diene-1,4-diamine (PubChem CID 155737997) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1E,3Z)-1-(3-methylpiperidin-1-yl)buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-(3-methylpiperidin-1-yl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 155737997 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1E,3Z)-1-(3-methylpiperidin-1-yl)buta-1,3-diene-1,4-diamine |
| SMILES | CC1CCCN(/C(N)=C/C=C\N)C1 |
| InChI | InChI=1S/C10H19N3/c1-9-4-3-7-13(8-9)10(12)5-2-6-11/h2,5-6,9H,3-4,7-8,11-12H2,1H3/b6-2-,10-5+ |
| InChIKey | QSJOUZNJEVDADF-REELITMLSA-N |
| XLogP | 0.99 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|