C10H14NRe- — CID 155738230
5-(2,2-dimethylpropyl)-3H-pyridin-3-ide;rhenium (PubChem CID 155738230) has the molecular formula C10H14NRe- and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-3H-pyridin-3-ide;rhenium.
| Compound Name | 5-(2,2-dimethylpropyl)-3H-pyridin-3-ide;rhenium |
|---|---|
| PubChem CID | 155738230 |
| Molecular Formula | C10H14NRe- |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-3H-pyridin-3-ide;rhenium |
| SMILES | CC(C)(C)Cc1c[c-]cnc1.[Re] |
| InChI | InChI=1S/C10H14N.Re/c1-10(2,3)7-9-5-4-6-11-8-9;/h5-6,8H,7H2,1-3H3;/q-1; |
| InChIKey | SAJKVKJZXSRKNB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|