C22H17ClF2N4 — CID 155738659
8-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-5,6-difluoroisoquinoline (PubChem CID 155738659) has the molecular formula C22H17ClF2N4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 8-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-5,6-difluoroisoquinoline.
| Compound Name | 8-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-5,6-difluoroisoquinoline |
|---|---|
| PubChem CID | 155738659 |
| Molecular Formula | C22H17ClF2N4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 8-[2-[3-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)cyclopenten-1-yl]ethyl]-5,6-difluoroisoquinoline |
| SMILES | Fc1cc(CCC2=CC(n3ccc4c(Cl)ncnc43)CC2)c2cnccc2c1F |
| InChI | InChI=1S/C22H17ClF2N4/c23-21-17-6-8-29(22(17)28-12-27-21)15-4-2-13(9-15)1-3-14-10-19(24)20(25)16-5-7-26-11-18(14)16/h5-12,15H,1-4H2 |
| InChIKey | KBDPHFPMLCIMEV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|