About methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile
methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile (PubChem CID 155739038) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile.
Molecular Properties
| Compound Name | methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile |
| PubChem CID | 155739038 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile |
| SMILES | CC1CCC1.N#CC1CC(OCc2ccccc2)CN1 |
| InChI | InChI=1S/C12H14N2O.C5H10/c13-7-11-6-12(8-14-11)15-9-10-4-2-1-3-5-10;1-5-3-2-4-5/h1-5,11-12,14H,6,8-9H2;5H,2-4H2,1H3 |
| InChIKey | DUZDOJHBXPADMD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile?
The IUPAC name of methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile (CID 155739038) is methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile.
What is the SMILES notation for methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile?
The canonical SMILES for methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile is CC1CCC1.N#CC1CC(OCc2ccccc2)CN1.
What is the InChIKey of methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile?
The InChIKey is DUZDOJHBXPADMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.C5H10/c13-7-11-6-12(8-14-11)15-9-10-4-2-1-3-5-10;1-5-3-2-4-5/h1-5,11-12,14H,6,8-9H2;5H,2-4H2,1H3.
What are the key properties of methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile?
methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile has a molecular weight of 272.39 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclobutane;4-phenylmethoxypyrrolidine-2-carbonitrile is sourced from PubChem (CID 155739038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).