About ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene
ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene (PubChem CID 155739040) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene.
Molecular Properties
| Compound Name | ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene |
| PubChem CID | 155739040 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene |
| SMILES | CC.Cc1ccccc1.O/N=C/[C@@H]1CC(OCc2ccccc2)CN1 |
| InChI | InChI=1S/C12H16N2O2.C7H8.C2H6/c15-14-7-11-6-12(8-13-11)16-9-10-4-2-1-3-5-10;1-7-5-3-2-4-6-7;1-2/h1-5,7,11-13,15H,6,8-9H2;2-6H,1H3;1-2H3/b14-7+;;/t11-,12?;;/m0../s1 |
| InChIKey | CHYZOEXJXQEYAN-VWWBIIANSA-N |
| XLogP | 4.41 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene?
The IUPAC name of ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene (CID 155739040) is ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene.
What is the SMILES notation for ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene?
The canonical SMILES for ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene is CC.Cc1ccccc1.O/N=C/[C@@H]1CC(OCc2ccccc2)CN1.
What is the InChIKey of ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene?
The InChIKey is CHYZOEXJXQEYAN-VWWBIIANSA-N. The full InChI is InChI=1S/C12H16N2O2.C7H8.C2H6/c15-14-7-11-6-12(8-13-11)16-9-10-4-2-1-3-5-10;1-7-5-3-2-4-6-7;1-2/h1-5,7,11-13,15H,6,8-9H2;2-6H,1H3;1-2H3/b14-7+;;/t11-,12?;;/m0../s1.
What are the key properties of ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene?
ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene has a molecular weight of 342.48 g/mol, XLogP of 4.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(NE)-N-[[(2S)-4-phenylmethoxypyrrolidin-2-yl]methylidene]hydroxylamine;toluene is sourced from PubChem (CID 155739040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).