C11H20N2O3 — CID 155739085
ethane;2-methylpropyl N-(2-methyl-1,3-oxazol-4-yl)carbamate (PubChem CID 155739085) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is ethane;2-methylpropyl N-(2-methyl-1,3-oxazol-4-yl)carbamate.
| Compound Name | ethane;2-methylpropyl N-(2-methyl-1,3-oxazol-4-yl)carbamate |
|---|---|
| PubChem CID | 155739085 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethane;2-methylpropyl N-(2-methyl-1,3-oxazol-4-yl)carbamate |
| SMILES | CC.Cc1nc(NC(=O)OCC(C)C)co1 |
| InChI | InChI=1S/C9H14N2O3.C2H6/c1-6(2)4-14-9(12)11-8-5-13-7(3)10-8;1-2/h5-6H,4H2,1-3H3,(H,11,12);1-2H3 |
| InChIKey | SIFILLQJDOEZIK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |