C22H35N5 — CID 155740029
N-methyl-N-propan-2-yl-5-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]pent-4-yn-1-amine (PubChem CID 155740029) has the molecular formula C22H35N5 and a molecular weight of 369.56 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-5-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]pent-4-yn-1-amine.
| Compound Name | N-methyl-N-propan-2-yl-5-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 155740029 |
| Molecular Formula | C22H35N5 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | N-methyl-N-propan-2-yl-5-[2-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrimidin-5-yl]pent-4-yn-1-amine |
| SMILES | CC(C)N(C)CCCC#Cc1cnc(N2C3CCC2CN(C(C)C)C3)nc1 |
| InChI | InChI=1S/C22H35N5/c1-17(2)25(5)12-8-6-7-9-19-13-23-22(24-14-19)27-20-10-11-21(27)16-26(15-20)18(3)4/h13-14,17-18,20-21H,6,8,10-12,15-16H2,1-5H3 |
| InChIKey | MNTMVAQPIUXKFH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|