C24H42N4O — CID 155740059
N-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl]-1-[(2R)-4-(4-methylpentyl)morpholin-2-yl]methanamine (PubChem CID 155740059) has the molecular formula C24H42N4O and a molecular weight of 402.63 g/mol. Its IUPAC name is N-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl]-1-[(2R)-4-(4-methylpentyl)morpholin-2-yl]methanamine.
| Compound Name | N-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl]-1-[(2R)-4-(4-methylpentyl)morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 155740059 |
| Molecular Formula | C24H42N4O |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.34 |
| IUPAC Name | N-[[4-(4-ethylpiperazin-1-yl)phenyl]methyl]-1-[(2R)-4-(4-methylpentyl)morpholin-2-yl]methanamine |
| SMILES | CCN1CCN(c2ccc(CNC[C@@H]3CN(CCCC(C)C)CCO3)cc2)CC1 |
| InChI | InChI=1S/C24H42N4O/c1-4-26-12-14-28(15-13-26)23-9-7-22(8-10-23)18-25-19-24-20-27(16-17-29-24)11-5-6-21(2)3/h7-10,21,24-25H,4-6,11-20H2,1-3H3/t24-/m1/s1 |
| InChIKey | IBOOMPLNFKZUPS-XMMPIXPASA-N |
| XLogP | 3.06 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|