C26H34ClFN5O7P — CID 155742700
2-ethylbutyl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155742700) has the molecular formula C26H34ClFN5O7P and a molecular weight of 614.01 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155742700 |
| Molecular Formula | C26H34ClFN5O7P |
| Molecular Weight | 614.01 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc3c(N)nc(Cl)nc32)[C@@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H34ClFN5O7P/c1-4-16(5-2)13-37-25(35)15(3)32-41(36,40-17-9-7-6-8-10-17)38-14-19-21(34)20(28)24(39-19)33-12-11-18-22(29)30-26(27)31-23(18)33/h6-12,15-16,19-21,24,34H,4-5,13-14H2,1-3H3,(H,32,36)(H2,29,30,31)/t15-,19+,20-,21+,24+,41?/m0/s1 |
| InChIKey | MXLLCUWXQSLTJE-KTRZHIFCSA-N |
| XLogP | 4.42 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.01 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|