About 2-(methanidylamino)-4-methylpentanenitrile;uranium
2-(methanidylamino)-4-methylpentanenitrile;uranium (PubChem CID 155743178) has the molecular formula C7H13N2U-
and a molecular weight of 363.22 g/mol. Its IUPAC name is 2-(methanidylamino)-4-methylpentanenitrile;uranium.
Molecular Properties
| Compound Name | 2-(methanidylamino)-4-methylpentanenitrile;uranium |
| PubChem CID | 155743178 |
| Molecular Formula | C7H13N2U- |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(methanidylamino)-4-methylpentanenitrile;uranium |
| SMILES | [CH2-]NC(C#N)CC(C)C.[U] |
| InChI | InChI=1S/C7H13N2.U/c1-6(2)4-7(5-8)9-3;/h6-7,9H,3-4H2,1-2H3;/q-1; |
| InChIKey | GBASMUVKGDVTQX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(methanidylamino)-4-methylpentanenitrile;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methanidylamino)-4-methylpentanenitrile;uranium?
The IUPAC name of 2-(methanidylamino)-4-methylpentanenitrile;uranium (CID 155743178) is 2-(methanidylamino)-4-methylpentanenitrile;uranium.
What is the SMILES notation for 2-(methanidylamino)-4-methylpentanenitrile;uranium?
The canonical SMILES for 2-(methanidylamino)-4-methylpentanenitrile;uranium is [CH2-]NC(C#N)CC(C)C.[U].
What is the InChIKey of 2-(methanidylamino)-4-methylpentanenitrile;uranium?
The InChIKey is GBASMUVKGDVTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2.U/c1-6(2)4-7(5-8)9-3;/h6-7,9H,3-4H2,1-2H3;/q-1;.
What are the key properties of 2-(methanidylamino)-4-methylpentanenitrile;uranium?
2-(methanidylamino)-4-methylpentanenitrile;uranium has a molecular weight of 363.22 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methanidylamino)-4-methylpentanenitrile;uranium is sourced from PubChem (CID 155743178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).