C20H27IN3O3PS — CID 155743220
ethane;N-iodophosphanyloxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]acetamide;prop-1-yne (PubChem CID 155743220) has the molecular formula C20H27IN3O3PS and a molecular weight of 547.40 g/mol. Its IUPAC name is ethane;N-iodophosphanyloxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]acetamide;prop-1-yne.
| Compound Name | ethane;N-iodophosphanyloxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]acetamide;prop-1-yne |
|---|---|
| PubChem CID | 155743220 |
| Molecular Formula | C20H27IN3O3PS |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | ethane;N-iodophosphanyloxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]acetamide;prop-1-yne |
| SMILES | C#CC.CC.COc1ccc(SN(CC(=O)NOPI)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C15H17IN3O3PS.C3H4.C2H6/c1-21-13-4-6-14(7-5-13)24-19(11-15(20)18-22-23-16)10-12-3-2-8-17-9-12;1-3-2;1-2/h2-9,23H,10-11H2,1H3,(H,18,20);1H,2H3;1-2H3 |
| InChIKey | KLTVWBOIVUKUKR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|