C21H20BrN3O3S — CID 142961768
5-bromo-N-hydroxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]-3-methylbenzamide (PubChem CID 142961768) has the molecular formula C21H20BrN3O3S and a molecular weight of 474.38 g/mol. Its IUPAC name is 5-bromo-N-hydroxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]-3-methylbenzamide.
| Compound Name | 5-bromo-N-hydroxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 142961768 |
| Molecular Formula | C21H20BrN3O3S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 5-bromo-N-hydroxy-2-[(4-methoxyphenyl)sulfanyl-(pyridin-3-ylmethyl)amino]-3-methylbenzamide |
| SMILES | COc1ccc(SN(Cc2cccnc2)c2c(C)cc(Br)cc2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H20BrN3O3S/c1-14-10-16(22)11-19(21(26)24-27)20(14)25(13-15-4-3-9-23-12-15)29-18-7-5-17(28-2)6-8-18/h3-12,27H,13H2,1-2H3,(H,24,26) |
| InChIKey | WZGAOLZIEXBZMV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|