C14H16BrNaO4 — CID 155744262
sodium (2S)-2-(4-bromo-2-cyclobutylphenoxy)-3-methoxypropanoate (PubChem CID 155744262) has the molecular formula C14H16BrNaO4 and a molecular weight of 351.17 g/mol. Its IUPAC name is sodium (2S)-2-(4-bromo-2-cyclobutylphenoxy)-3-methoxypropanoate.
| Compound Name | sodium (2S)-2-(4-bromo-2-cyclobutylphenoxy)-3-methoxypropanoate |
|---|---|
| PubChem CID | 155744262 |
| Molecular Formula | C14H16BrNaO4 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | sodium (2S)-2-(4-bromo-2-cyclobutylphenoxy)-3-methoxypropanoate |
| SMILES | COC[C@H](Oc1ccc(Br)cc1C1CCC1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H17BrO4.Na/c1-18-8-13(14(16)17)19-12-6-5-10(15)7-11(12)9-3-2-4-9;/h5-7,9,13H,2-4,8H2,1H3,(H,16,17);/q;+1/p-1/t13-;/m0./s1 |
| InChIKey | ULZLLQDTRATDDO-ZOWNYOTGSA-M |
| XLogP | -1.14 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |