C10H8Br2ClO3- — CID 57361990
4-chloro-2-(2,4-dibromophenoxy)butanoate (PubChem CID 57361990) has the molecular formula C10H8Br2ClO3- and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dibromophenoxy)butanoate.
| Compound Name | 4-chloro-2-(2,4-dibromophenoxy)butanoate |
|---|---|
| PubChem CID | 57361990 |
| Molecular Formula | C10H8Br2ClO3- |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 368.85 |
| IUPAC Name | 4-chloro-2-(2,4-dibromophenoxy)butanoate |
| SMILES | O=C([O-])C(CCCl)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H9Br2ClO3/c11-6-1-2-8(7(12)5-6)16-9(3-4-13)10(14)15/h1-2,5,9H,3-4H2,(H,14,15)/p-1 |
| InChIKey | LMXHNLURCFHPNB-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|