C8H15NO5S — CID 155745301
2-(hydroxymethyl)-6-(2-iminoethylsulfanyl)oxane-3,4,5-triol (PubChem CID 155745301) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(2-iminoethylsulfanyl)oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(2-iminoethylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155745301 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(hydroxymethyl)-6-(2-iminoethylsulfanyl)oxane-3,4,5-triol |
| SMILES | [H]/N=C/CSC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C8H15NO5S/c9-1-2-15-8-7(13)6(12)5(11)4(3-10)14-8/h1,4-13H,2-3H2/b9-1+ |
| InChIKey | MWLHIOVEZNZMTL-XLUWADSXSA-N |
| XLogP | -1.83 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|