C9H17NO6S — CID 89322801
methyl 2-[(3S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethanimidate (PubChem CID 89322801) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is methyl 2-[(3S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethanimidate.
| Compound Name | methyl 2-[(3S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 89322801 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | methyl 2-[(3S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylethanimidate |
| SMILES | [H]/N=C(/CSC1OC(CO)C(O)C(O)[C@@H]1O)OC |
| InChI | InChI=1S/C9H17NO6S/c1-15-5(10)3-17-9-8(14)7(13)6(12)4(2-11)16-9/h4,6-14H,2-3H2,1H3/b10-5-/t4?,6?,7?,8-,9?/m0/s1 |
| InChIKey | QMZQMASPATYOGL-ANBFNCEQSA-N |
| XLogP | -1.86 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|