C19H29NO — CID 155746533
(3Z,5E,6Z)-5-ethylidene-7-methoxy-N-methyl-9-methylidene-3-prop-1-en-2-ylundeca-3,6,10-trien-1-amine (PubChem CID 155746533) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (3Z,5E,6Z)-5-ethylidene-7-methoxy-N-methyl-9-methylidene-3-prop-1-en-2-ylundeca-3,6,10-trien-1-amine.
| Compound Name | (3Z,5E,6Z)-5-ethylidene-7-methoxy-N-methyl-9-methylidene-3-prop-1-en-2-ylundeca-3,6,10-trien-1-amine |
|---|---|
| PubChem CID | 155746533 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (3Z,5E,6Z)-5-ethylidene-7-methoxy-N-methyl-9-methylidene-3-prop-1-en-2-ylundeca-3,6,10-trien-1-amine |
| SMILES | C=CC(=C)C/C(=C/C(=C/C)/C=C(\CCNC)C(=C)C)OC |
| InChI | InChI=1S/C19H29NO/c1-8-16(5)12-19(21-7)14-17(9-2)13-18(15(3)4)10-11-20-6/h8-9,13-14,20H,1,3,5,10-12H2,2,4,6-7H3/b17-9+,18-13-,19-14- |
| InChIKey | HTWWYZDMTZGSNE-YLPGSLASSA-N |
| XLogP | 4.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|