C13H12N2O — CID 155748425
N-ethyl-2,6-diethynyl-N-methylpyridine-4-carboxamide (PubChem CID 155748425) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is N-ethyl-2,6-diethynyl-N-methylpyridine-4-carboxamide.
| Compound Name | N-ethyl-2,6-diethynyl-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 155748425 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | N-ethyl-2,6-diethynyl-N-methylpyridine-4-carboxamide |
| SMILES | C#Cc1cc(C(=O)N(C)CC)cc(C#C)n1 |
| InChI | InChI=1S/C13H12N2O/c1-5-11-8-10(9-12(6-2)14-11)13(16)15(4)7-3/h1-2,8-9H,7H2,3-4H3 |
| InChIKey | KEKBQYNYZLVXAH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|