C34H46FN4O2P — CID 155750379
N-[3-[1-[[(5Z,6E)-5,6-di(butylidene)-3,4-dihydro-1,4-azaphosphinin-3-yl]amino]ethyl]-4-methylphenyl]-3-fluoro-4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-5-methylbenzamide (PubChem CID 155750379) has the molecular formula C34H46FN4O2P and a molecular weight of 592.74 g/mol. Its IUPAC name is N-[3-[1-[[(5Z,6E)-5,6-di(butylidene)-3,4-dihydro-1,4-azaphosphinin-3-yl]amino]ethyl]-4-methylphenyl]-3-fluoro-4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-5-methylbenzamide.
| Compound Name | N-[3-[1-[[(5Z,6E)-5,6-di(butylidene)-3,4-dihydro-1,4-azaphosphinin-3-yl]amino]ethyl]-4-methylphenyl]-3-fluoro-4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 155750379 |
| Molecular Formula | C34H46FN4O2P |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | N-[3-[1-[[(5Z,6E)-5,6-di(butylidene)-3,4-dihydro-1,4-azaphosphinin-3-yl]amino]ethyl]-4-methylphenyl]-3-fluoro-4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-5-methylbenzamide |
| SMILES | CCC/C=C1\PC(NC(C)c2cc(NC(=O)c3cc(C)c(CN4CC[C@@H](O)C4)c(F)c3)ccc2C)C=N\C1=C\CCC |
| InChI | InChI=1S/C34H46FN4O2P/c1-6-8-10-31-32(11-9-7-2)42-33(19-36-31)37-24(5)28-18-26(13-12-22(28)3)38-34(41)25-16-23(4)29(30(35)17-25)21-39-15-14-27(40)20-39/h10-13,16-19,24,27,33,37,40,42H,6-9,14-15,20-21H2,1-5H3,(H,38,41)/b31-10+,32-11-/t24?,27-,33?/m1/s1 |
| InChIKey | QATLLLDPVVUSGQ-ZIWGMOLESA-N |
| XLogP | 7.37 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|