C13H11FN2O4 — CID 155751620
3-[(3Z)-3-(1-fluoroprop-2-enylidene)-4-methylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione (PubChem CID 155751620) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[(3Z)-3-(1-fluoroprop-2-enylidene)-4-methylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(3Z)-3-(1-fluoroprop-2-enylidene)-4-methylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155751620 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[(3Z)-3-(1-fluoroprop-2-enylidene)-4-methylidene-2,5-dioxopyrrolidin-1-yl]piperidine-2,6-dione |
| SMILES | C=C/C(F)=C1\C(=C)C(=O)N(C2CCC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C13H11FN2O4/c1-3-7(14)10-6(2)12(19)16(13(10)20)8-4-5-9(17)15-11(8)18/h3,8H,1-2,4-5H2,(H,15,17,18)/b10-7- |
| InChIKey | GDULPDARDBSTLX-YFHOEESVSA-N |
| XLogP | 0.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|