C32H32F2N6O6 — CID 155755702
1-N'-[2-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 155755702) has the molecular formula C32H32F2N6O6 and a molecular weight of 634.64 g/mol. Its IUPAC name is 1-N'-[2-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155755702 |
| Molecular Formula | C32H32F2N6O6 |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 1-N'-[2-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1nc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)c(F)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C32H32F2N6O6/c1-43-28-26(45-14-2-11-40-12-15-44-16-13-40)18-25-27(39-28)29(36-19-35-25)46-22-7-8-24(23(34)17-22)38-31(42)32(9-10-32)30(41)37-21-5-3-20(33)4-6-21/h3-8,17-19H,2,9-16H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | MDPOPHVGJVVQRZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|