C34H34ClFN4O6 — CID 159805106
1-[1-[2-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 159805106) has the molecular formula C34H34ClFN4O6 and a molecular weight of 649.12 g/mol. Its IUPAC name is 1-[1-[2-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 159805106 |
| Molecular Formula | C34H34ClFN4O6 |
| Molecular Weight | 649.12 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 1-[1-[2-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)pyrido[3,2-d]pyrimidin-4-yl]oxyphenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | COc1nc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)c(Cl)c3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H34ClFN4O6/c1-43-32-28(45-14-2-11-40-12-15-44-16-13-40)20-27-31(39-32)33(38-21-37-27)46-25-8-5-23(26(35)19-25)18-30(42)34(9-10-34)29(41)17-22-3-6-24(36)7-4-22/h3-8,19-21H,2,9-18H2,1H3 |
| InChIKey | NKHFTYOONUOSIW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 112.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.12 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|