C8H12O3 — CID 155761046
(1R,3aS,7aR)-1-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-one (PubChem CID 155761046) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1R,3aS,7aR)-1-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-one.
| Compound Name | (1R,3aS,7aR)-1-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-one |
|---|---|
| PubChem CID | 155761046 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (1R,3aS,7aR)-1-hydroxy-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-one |
| SMILES | O=C1CC[C@@H]2[C@@H](CO[C@H]2O)C1 |
| InChI | InChI=1S/C8H12O3/c9-6-1-2-7-5(3-6)4-11-8(7)10/h5,7-8,10H,1-4H2/t5-,7-,8-/m1/s1 |
| InChIKey | LBNVUVIFAYQXMC-LPBLVHEISA-N |
| XLogP | 0.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |